2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid

C11H9ClO5 — CID 117394741

IUPAC2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid
SMILESCC1(C)Oc2cc(C(=O)C(=O)O)cc(Cl)c2O1
InChIInChI=1S/C11H9ClO5/c1-11(2)16-7-4-5(8(13)10(14)15)3-6(12)9(7)17-11/h3-4H,1-2H3,(H,14,15)
InChIKeyYRCUSXGFGSCLQE-UHFFFAOYSA-N
MW256.64 g/mol
LogP2.11
Rot. Bonds2

About 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid

2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid (PubChem CID 117394741) has the molecular formula C11H9ClO5 and a molecular weight of 256.64 g/mol. Its IUPAC name is 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid
PubChem CID117394741
Molecular FormulaC11H9ClO5
Molecular Weight256.64 g/mol
Exact Mass256.01
IUPAC Name2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid
SMILESCC1(C)Oc2cc(C(=O)C(=O)O)cc(Cl)c2O1
InChIInChI=1S/C11H9ClO5/c1-11(2)16-7-4-5(8(13)10(14)15)3-6(12)9(7)17-11/h3-4H,1-2H3,(H,14,15)
InChIKeyYRCUSXGFGSCLQE-UHFFFAOYSA-N
XLogP2.11
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.64
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
The IUPAC name of 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid (CID 117394741) is 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid is CC1(C)Oc2cc(C(=O)C(=O)O)cc(Cl)c2O1.
What is the InChIKey of 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
The InChIKey is YRCUSXGFGSCLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO5/c1-11(2)16-7-4-5(8(13)10(14)15)3-6(12)9(7)17-11/h3-4H,1-2H3,(H,14,15).
What are the key properties of 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid has a molecular weight of 256.64 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid is sourced from PubChem (CID 117394741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).