C10H9ClO3S2 — CID 117443401
2-[3-chloro-4,5-bis(methylsulfanyl)phenyl]-2-oxoacetic acid (PubChem CID 117443401) has the molecular formula C10H9ClO3S2 and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-[3-chloro-4,5-bis(methylsulfanyl)phenyl]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4,5-bis(methylsulfanyl)phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117443401 |
| Molecular Formula | C10H9ClO3S2 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 2-[3-chloro-4,5-bis(methylsulfanyl)phenyl]-2-oxoacetic acid |
| SMILES | CSc1cc(C(=O)C(=O)O)cc(Cl)c1SC |
| InChI | InChI=1S/C10H9ClO3S2/c1-15-7-4-5(8(12)10(13)14)3-6(11)9(7)16-2/h3-4H,1-2H3,(H,13,14) |
| InChIKey | IMCPMRYKTQGZOW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|