C10H13ClOS2 — CID 117375050
1-[3-chloro-4,5-bis(methylsulfanyl)phenyl]ethanol (PubChem CID 117375050) has the molecular formula C10H13ClOS2 and a molecular weight of 248.80 g/mol. Its IUPAC name is 1-[3-chloro-4,5-bis(methylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[3-chloro-4,5-bis(methylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117375050 |
| Molecular Formula | C10H13ClOS2 |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1-[3-chloro-4,5-bis(methylsulfanyl)phenyl]ethanol |
| SMILES | CSc1cc(C(C)O)cc(Cl)c1SC |
| InChI | InChI=1S/C10H13ClOS2/c1-6(12)7-4-8(11)10(14-3)9(5-7)13-2/h4-6,12H,1-3H3 |
| InChIKey | UYXDOBZJTVMVRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |