C17H16O4S3 — CID 141407003
5-[3,4,5-tris(methylsulfanyl)phenyl]benzene-1,3-dicarboxylic acid (PubChem CID 141407003) has the molecular formula C17H16O4S3 and a molecular weight of 380.51 g/mol. Its IUPAC name is 5-[3,4,5-tris(methylsulfanyl)phenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3,4,5-tris(methylsulfanyl)phenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141407003 |
| Molecular Formula | C17H16O4S3 |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 5-[3,4,5-tris(methylsulfanyl)phenyl]benzene-1,3-dicarboxylic acid |
| SMILES | CSc1cc(-c2cc(C(=O)O)cc(C(=O)O)c2)cc(SC)c1SC |
| InChI | InChI=1S/C17H16O4S3/c1-22-13-7-10(8-14(23-2)15(13)24-3)9-4-11(16(18)19)6-12(5-9)17(20)21/h4-8H,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | XRVWGZHISGVPIY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |