About 3-chloro-4,5-difluorobenzoyl fluoride
3-chloro-4,5-difluorobenzoyl fluoride (PubChem CID 19850493) has the molecular formula C7H2ClF3O
and a molecular weight of 194.54 g/mol. Its IUPAC name is 3-chloro-4,5-difluorobenzoyl fluoride.
Molecular Properties
| Compound Name | 3-chloro-4,5-difluorobenzoyl fluoride |
| PubChem CID | 19850493 |
| Molecular Formula | C7H2ClF3O |
| Molecular Weight | 194.54 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 3-chloro-4,5-difluorobenzoyl fluoride |
| SMILES | O=C(F)c1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C7H2ClF3O/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H |
| InChIKey | RBGXYABFTXLEPI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4,5-difluorobenzoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4,5-difluorobenzoyl fluoride?
The IUPAC name of 3-chloro-4,5-difluorobenzoyl fluoride (CID 19850493) is 3-chloro-4,5-difluorobenzoyl fluoride.
What is the SMILES notation for 3-chloro-4,5-difluorobenzoyl fluoride?
The canonical SMILES for 3-chloro-4,5-difluorobenzoyl fluoride is O=C(F)c1cc(F)c(F)c(Cl)c1.
What is the InChIKey of 3-chloro-4,5-difluorobenzoyl fluoride?
The InChIKey is RBGXYABFTXLEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClF3O/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H.
What are the key properties of 3-chloro-4,5-difluorobenzoyl fluoride?
3-chloro-4,5-difluorobenzoyl fluoride has a molecular weight of 194.54 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4,5-difluorobenzoyl fluoride is sourced from PubChem (CID 19850493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).