C8H7Cl3FNO — CID 122235372
2-amino-1-(3,5-dichloro-4-fluorophenyl)ethanone;hydrochloride (PubChem CID 122235372) has the molecular formula C8H7Cl3FNO and a molecular weight of 258.51 g/mol. Its IUPAC name is 2-amino-1-(3,5-dichloro-4-fluorophenyl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-(3,5-dichloro-4-fluorophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 122235372 |
| Molecular Formula | C8H7Cl3FNO |
| Molecular Weight | 258.51 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | 2-amino-1-(3,5-dichloro-4-fluorophenyl)ethanone;hydrochloride |
| SMILES | Cl.NCC(=O)c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2FNO.ClH/c9-5-1-4(7(13)3-12)2-6(10)8(5)11;/h1-2H,3,12H2;1H |
| InChIKey | HDMOSMKZFGBRAI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|