C9H7F2NO3 — CID 117306137
4-(2-aminoacetyl)-2,6-difluorobenzoic acid (PubChem CID 117306137) has the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. Its IUPAC name is 4-(2-aminoacetyl)-2,6-difluorobenzoic acid.
| Compound Name | 4-(2-aminoacetyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 117306137 |
| Molecular Formula | C9H7F2NO3 |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4-(2-aminoacetyl)-2,6-difluorobenzoic acid |
| SMILES | NCC(=O)c1cc(F)c(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C9H7F2NO3/c10-5-1-4(7(13)3-12)2-6(11)8(5)9(14)15/h1-2H,3,12H2,(H,14,15) |
| InChIKey | DCKPTZLZVOEYJW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |