C7H6Cl2FN3S — CID 51000156
1-amino-3-(3,5-dichloro-4-fluorophenyl)thiourea (PubChem CID 51000156) has the molecular formula C7H6Cl2FN3S and a molecular weight of 254.12 g/mol. Its IUPAC name is 1-amino-3-(3,5-dichloro-4-fluorophenyl)thiourea.
| Compound Name | 1-amino-3-(3,5-dichloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 51000156 |
| Molecular Formula | C7H6Cl2FN3S |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 1-amino-3-(3,5-dichloro-4-fluorophenyl)thiourea |
| SMILES | NNC(=S)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2FN3S/c8-4-1-3(12-7(14)13-11)2-5(9)6(4)10/h1-2H,11H2,(H2,12,13,14) |
| InChIKey | QOZYESXHIHONTM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|