C13H9BrClF2N3 — CID 102854536
N-(5-bromo-2,4-difluorophenyl)-6-chloro-2-cyclopropylpyrimidin-4-amine (PubChem CID 102854536) has the molecular formula C13H9BrClF2N3 and a molecular weight of 360.59 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-6-chloro-2-cyclopropylpyrimidin-4-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-6-chloro-2-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102854536 |
| Molecular Formula | C13H9BrClF2N3 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-6-chloro-2-cyclopropylpyrimidin-4-amine |
| SMILES | Fc1cc(F)c(Nc2cc(Cl)nc(C3CC3)n2)cc1Br |
| InChI | InChI=1S/C13H9BrClF2N3/c14-7-3-10(9(17)4-8(7)16)18-12-5-11(15)19-13(20-12)6-1-2-6/h3-6H,1-2H2,(H,18,19,20) |
| InChIKey | ZMCZGGFDSDFAAF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|