C9H3BrCl2F2N4 — CID 102854532
N-(5-bromo-2,4-difluorophenyl)-4,6-dichloro-1,3,5-triazin-2-amine (PubChem CID 102854532) has the molecular formula C9H3BrCl2F2N4 and a molecular weight of 355.96 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-4,6-dichloro-1,3,5-triazin-2-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 102854532 |
| Molecular Formula | C9H3BrCl2F2N4 |
| Molecular Weight | 355.96 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
| SMILES | Fc1cc(F)c(Nc2nc(Cl)nc(Cl)n2)cc1Br |
| InChI | InChI=1S/C9H3BrCl2F2N4/c10-3-1-6(5(14)2-4(3)13)15-9-17-7(11)16-8(12)18-9/h1-2H,(H,15,16,17,18) |
| InChIKey | VTNXIMKGYUJBIX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|