C10H8BrF2N5O — CID 102855487
2-N-(5-bromo-2,4-difluorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine (PubChem CID 102855487) has the molecular formula C10H8BrF2N5O and a molecular weight of 332.11 g/mol. Its IUPAC name is 2-N-(5-bromo-2,4-difluorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(5-bromo-2,4-difluorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 102855487 |
| Molecular Formula | C10H8BrF2N5O |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-N-(5-bromo-2,4-difluorophenyl)-6-methoxy-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N)nc(Nc2cc(Br)c(F)cc2F)n1 |
| InChI | InChI=1S/C10H8BrF2N5O/c1-19-10-17-8(14)16-9(18-10)15-7-2-4(11)5(12)3-6(7)13/h2-3H,1H3,(H3,14,15,16,17,18) |
| InChIKey | INMPVSWNPYJJIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|