C10H8F3N5O — CID 80825019
6-methoxy-2-N-(2,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80825019) has the molecular formula C10H8F3N5O and a molecular weight of 271.20 g/mol. Its IUPAC name is 6-methoxy-2-N-(2,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methoxy-2-N-(2,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80825019 |
| Molecular Formula | C10H8F3N5O |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 6-methoxy-2-N-(2,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N)nc(Nc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C10H8F3N5O/c1-19-10-17-8(14)16-9(18-10)15-7-3-5(12)4(11)2-6(7)13/h2-3H,1H3,(H3,14,15,16,17,18) |
| InChIKey | IGPFTKGMXAAJEO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|