C12H10BrClF2N4O — CID 107614894
N-(4-bromo-2,5-difluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 107614894) has the molecular formula C12H10BrClF2N4O and a molecular weight of 379.59 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 107614894 |
| Molecular Formula | C12H10BrClF2N4O |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-4-chloro-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(Cl)nc(Nc2cc(F)c(Br)cc2F)n1 |
| InChI | InChI=1S/C12H10BrClF2N4O/c1-2-3-21-12-19-10(14)18-11(20-12)17-9-5-7(15)6(13)4-8(9)16/h4-5H,2-3H2,1H3,(H,17,18,19,20) |
| InChIKey | PBCOBLQFAWCFJZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|