C14H13Cl2N3 — CID 80948774
6-chloro-N-(5-chloro-2-methylphenyl)-2-cyclopropylpyrimidin-4-amine (PubChem CID 80948774) has the molecular formula C14H13Cl2N3 and a molecular weight of 294.19 g/mol. Its IUPAC name is 6-chloro-N-(5-chloro-2-methylphenyl)-2-cyclopropylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(5-chloro-2-methylphenyl)-2-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80948774 |
| Molecular Formula | C14H13Cl2N3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 6-chloro-N-(5-chloro-2-methylphenyl)-2-cyclopropylpyrimidin-4-amine |
| SMILES | Cc1ccc(Cl)cc1Nc1cc(Cl)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H13Cl2N3/c1-8-2-5-10(15)6-11(8)17-13-7-12(16)18-14(19-13)9-3-4-9/h2,5-7,9H,3-4H2,1H3,(H,17,18,19) |
| InChIKey | ISROBTDEMXZLGW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |