C15H19N5 — CID 80968268
2-cyclopropyl-N-(2,5-dimethylphenyl)-6-hydrazinylpyrimidin-4-amine (PubChem CID 80968268) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2,5-dimethylphenyl)-6-hydrazinylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-(2,5-dimethylphenyl)-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80968268 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-cyclopropyl-N-(2,5-dimethylphenyl)-6-hydrazinylpyrimidin-4-amine |
| SMILES | Cc1ccc(C)c(Nc2cc(NN)nc(C3CC3)n2)c1 |
| InChI | InChI=1S/C15H19N5/c1-9-3-4-10(2)12(7-9)17-13-8-14(20-16)19-15(18-13)11-5-6-11/h3-4,7-8,11H,5-6,16H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | DQWDOIVLYMTTLT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|