C15H19N5O — CID 80964846
2-cyclopropyl-6-hydrazinyl-N-(4-methoxy-2-methylphenyl)pyrimidin-4-amine (PubChem CID 80964846) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-cyclopropyl-6-hydrazinyl-N-(4-methoxy-2-methylphenyl)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-hydrazinyl-N-(4-methoxy-2-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80964846 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-cyclopropyl-6-hydrazinyl-N-(4-methoxy-2-methylphenyl)pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2cc(NN)nc(C3CC3)n2)c(C)c1 |
| InChI | InChI=1S/C15H19N5O/c1-9-7-11(21-2)5-6-12(9)17-13-8-14(20-16)19-15(18-13)10-3-4-10/h5-8,10H,3-4,16H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | XOOMNPJNGRYYFO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|