C16H18ClN3O2S — CID 133421758
6-chloro-2-cyclopropyl-N-[4-(2-methylsulfonylethyl)phenyl]pyrimidin-4-amine (PubChem CID 133421758) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-[4-(2-methylsulfonylethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-[4-(2-methylsulfonylethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133421758 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-[4-(2-methylsulfonylethyl)phenyl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)CCc1ccc(Nc2cc(Cl)nc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-23(21,22)9-8-11-2-6-13(7-3-11)18-15-10-14(17)19-16(20-15)12-4-5-12/h2-3,6-7,10,12H,4-5,8-9H2,1H3,(H,18,19,20) |
| InChIKey | ZKNZFYWLAHTTKT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |