C14H9FN2O2 — CID 107957590
4-fluoro-3-imidazo[1,2-a]pyridin-5-ylbenzoic acid (PubChem CID 107957590) has the molecular formula C14H9FN2O2 and a molecular weight of 256.24 g/mol. Its IUPAC name is 4-fluoro-3-imidazo[1,2-a]pyridin-5-ylbenzoic acid.
| Compound Name | 4-fluoro-3-imidazo[1,2-a]pyridin-5-ylbenzoic acid |
|---|---|
| PubChem CID | 107957590 |
| Molecular Formula | C14H9FN2O2 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-fluoro-3-imidazo[1,2-a]pyridin-5-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(-c2cccc3nccn23)c1 |
| InChI | InChI=1S/C14H9FN2O2/c15-11-5-4-9(14(18)19)8-10(11)12-2-1-3-13-16-6-7-17(12)13/h1-8H,(H,18,19) |
| InChIKey | FUHCERRBOXXGON-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |