2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid

C15H12N2O2 — CID 102626289

IUPAC2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid
SMILESCc1ccc(-c2cccc3nccn23)c(C(=O)O)c1
InChIInChI=1S/C15H12N2O2/c1-10-5-6-11(12(9-10)15(18)19)13-3-2-4-14-16-7-8-17(13)14/h2-9H,1H3,(H,18,19)
InChIKeyCEAZVRFITXQOQN-UHFFFAOYSA-N
MW252.27 g/mol
LogP3.01
Rot. Bonds2

About 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid

2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid (PubChem CID 102626289) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid.

Molecular Properties

Compound Name2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid
PubChem CID102626289
Molecular FormulaC15H12N2O2
Molecular Weight252.27 g/mol
Exact Mass252.09
IUPAC Name2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid
SMILESCc1ccc(-c2cccc3nccn23)c(C(=O)O)c1
InChIInChI=1S/C15H12N2O2/c1-10-5-6-11(12(9-10)15(18)19)13-3-2-4-14-16-7-8-17(13)14/h2-9H,1H3,(H,18,19)
InChIKeyCEAZVRFITXQOQN-UHFFFAOYSA-N
XLogP3.01
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 53.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid?
The IUPAC name of 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid (CID 102626289) is 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid.
What is the SMILES notation for 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid?
The canonical SMILES for 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid is Cc1ccc(-c2cccc3nccn23)c(C(=O)O)c1.
What is the InChIKey of 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid?
The InChIKey is CEAZVRFITXQOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2/c1-10-5-6-11(12(9-10)15(18)19)13-3-2-4-14-16-7-8-17(13)14/h2-9H,1H3,(H,18,19).
What are the key properties of 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid?
2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid has a molecular weight of 252.27 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-a]pyridin-5-yl-5-methylbenzoic acid is sourced from PubChem (CID 102626289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).