C9H4N4O2S2 — CID 113324328
5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzonitrile (PubChem CID 113324328) has the molecular formula C9H4N4O2S2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzonitrile.
| Compound Name | 5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 113324328 |
| Molecular Formula | C9H4N4O2S2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Sc1ncns1 |
| InChI | InChI=1S/C9H4N4O2S2/c10-4-6-3-7(13(14)15)1-2-8(6)16-9-11-5-12-17-9/h1-3,5H |
| InChIKey | MTBBMSILMWUXQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|