C8H7ClF2N2O5 — CID 87275022
2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride (PubChem CID 87275022) has the molecular formula C8H7ClF2N2O5 and a molecular weight of 284.60 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride.
| Compound Name | 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 87275022 |
| Molecular Formula | C8H7ClF2N2O5 |
| Molecular Weight | 284.60 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc([N+](=O)[O-])cnc1OCC(F)F |
| InChI | InChI=1S/C8H6F2N2O5.ClH/c9-6(10)3-17-7-5(8(13)14)1-4(2-11-7)12(15)16;/h1-2,6H,3H2,(H,13,14);1H |
| InChIKey | AGXAORYAGGWCMO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.60 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|