About 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride
2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride (PubChem CID 87275022) has the molecular formula C8H7ClF2N2O5
and a molecular weight of 284.60 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride |
| PubChem CID | 87275022 |
| Molecular Formula | C8H7ClF2N2O5 |
| Molecular Weight | 284.60 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc([N+](=O)[O-])cnc1OCC(F)F |
| InChI | InChI=1S/C8H6F2N2O5.ClH/c9-6(10)3-17-7-5(8(13)14)1-4(2-11-7)12(15)16;/h1-2,6H,3H2,(H,13,14);1H |
| InChIKey | AGXAORYAGGWCMO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.60 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride?
The IUPAC name of 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride (CID 87275022) is 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride?
The canonical SMILES for 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride is Cl.O=C(O)c1cc([N+](=O)[O-])cnc1OCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride?
The InChIKey is AGXAORYAGGWCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N2O5.ClH/c9-6(10)3-17-7-5(8(13)14)1-4(2-11-7)12(15)16;/h1-2,6H,3H2,(H,13,14);1H.
What are the key properties of 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride?
2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride has a molecular weight of 284.60 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-5-nitropyridine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 87275022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).