C11H12N4O4 — CID 15129640
(2,4-dinitrophenyl)-(2-methylbut-3-en-2-yl)diazene (PubChem CID 15129640) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-(2-methylbut-3-en-2-yl)diazene.
| Compound Name | (2,4-dinitrophenyl)-(2-methylbut-3-en-2-yl)diazene |
|---|---|
| PubChem CID | 15129640 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (2,4-dinitrophenyl)-(2-methylbut-3-en-2-yl)diazene |
| SMILES | C=CC(C)(C)/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N4O4/c1-4-11(2,3)13-12-9-6-5-8(14(16)17)7-10(9)15(18)19/h4-7H,1H2,2-3H3/b13-12+ |
| InChIKey | NHAKUVAZTKWVIX-OUKQBFOZSA-N |
| XLogP | 3.55 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|