C14H14N4O6 — CID 102293103
prop-2-enyl (E)-3-[(2,4-dinitrophenyl)diazenyl]-2-methylbut-2-enoate (PubChem CID 102293103) has the molecular formula C14H14N4O6 and a molecular weight of 334.29 g/mol. Its IUPAC name is prop-2-enyl (E)-3-[(2,4-dinitrophenyl)diazenyl]-2-methylbut-2-enoate.
| Compound Name | prop-2-enyl (E)-3-[(2,4-dinitrophenyl)diazenyl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102293103 |
| Molecular Formula | C14H14N4O6 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | prop-2-enyl (E)-3-[(2,4-dinitrophenyl)diazenyl]-2-methylbut-2-enoate |
| SMILES | C=CCOC(=O)/C(C)=C(C)/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N4O6/c1-4-7-24-14(19)9(2)10(3)15-16-12-6-5-11(17(20)21)8-13(12)18(22)23/h4-6,8H,1,7H2,2-3H3/b10-9+,16-15+ |
| InChIKey | OKBSHCAKYLEMJS-DSIBUQCCSA-N |
| XLogP | 3.61 |
| TPSA | 137.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|