C12H12N4O4 — CID 131880074
2,3-dimethylbuta-1,3-dienyl-(2,4-dinitrophenyl)diazene (PubChem CID 131880074) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2,3-dimethylbuta-1,3-dienyl-(2,4-dinitrophenyl)diazene.
| Compound Name | 2,3-dimethylbuta-1,3-dienyl-(2,4-dinitrophenyl)diazene |
|---|---|
| PubChem CID | 131880074 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2,3-dimethylbuta-1,3-dienyl-(2,4-dinitrophenyl)diazene |
| SMILES | C=C(C)C(C)=C/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O4/c1-8(2)9(3)7-13-14-11-5-4-10(15(17)18)6-12(11)16(19)20/h4-7H,1H2,2-3H3/b9-7?,14-13+ |
| InChIKey | UAARKNXWSZWJIX-IBVVYBLGSA-N |
| XLogP | 4.07 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|