C9H7N3O6 — CID 71372052
2-(2,4-dinitrophenyl)iminopropanoic acid (PubChem CID 71372052) has the molecular formula C9H7N3O6 and a molecular weight of 253.17 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)iminopropanoic acid.
| Compound Name | 2-(2,4-dinitrophenyl)iminopropanoic acid |
|---|---|
| PubChem CID | 71372052 |
| Molecular Formula | C9H7N3O6 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-(2,4-dinitrophenyl)iminopropanoic acid |
| SMILES | C/C(=N\c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H7N3O6/c1-5(9(13)14)10-7-3-2-6(11(15)16)4-8(7)12(17)18/h2-4H,1H3,(H,13,14)/b10-5+ |
| InChIKey | NIXYNDSYGVOHPM-BJMVGYQFSA-N |
| XLogP | 1.68 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|