C16H14ClN3O4S — CID 134917293
N-(2,4-dinitrophenyl)-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride (PubChem CID 134917293) has the molecular formula C16H14ClN3O4S and a molecular weight of 379.83 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride.
| Compound Name | N-(2,4-dinitrophenyl)-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride |
|---|---|
| PubChem CID | 134917293 |
| Molecular Formula | C16H14ClN3O4S |
| Molecular Weight | 379.83 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-(2,4-dinitrophenyl)-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride |
| SMILES | Cc1cc(C)c(S/C(Cl)=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C16H14ClN3O4S/c1-9-6-10(2)15(11(3)7-9)25-16(17)18-13-5-4-12(19(21)22)8-14(13)20(23)24/h4-8H,1-3H3/b18-16+ |
| InChIKey | ZDCBGKYCJFCPDB-FBMGVBCBSA-N |
| XLogP | 5.45 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|