C14H16N4O4 — CID 15129643
(2,4-dinitrophenyl)-(1-ethenylcyclohexyl)diazene (PubChem CID 15129643) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-(1-ethenylcyclohexyl)diazene.
| Compound Name | (2,4-dinitrophenyl)-(1-ethenylcyclohexyl)diazene |
|---|---|
| PubChem CID | 15129643 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (2,4-dinitrophenyl)-(1-ethenylcyclohexyl)diazene |
| SMILES | C=CC1(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCCCC1 |
| InChI | InChI=1S/C14H16N4O4/c1-2-14(8-4-3-5-9-14)16-15-12-7-6-11(17(19)20)10-13(12)18(21)22/h2,6-7,10H,1,3-5,8-9H2/b16-15+ |
| InChIKey | UPSARJNWPQKXJO-FOCLMDBBSA-N |
| XLogP | 4.48 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|