C16H19N5O6 — CID 72767288
(2,4-dinitrophenyl)-(1,7,7-trimethyl-2-nitro-2-bicyclo[2.2.1]heptanyl)diazene (PubChem CID 72767288) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-(1,7,7-trimethyl-2-nitro-2-bicyclo[2.2.1]heptanyl)diazene.
| Compound Name | (2,4-dinitrophenyl)-(1,7,7-trimethyl-2-nitro-2-bicyclo[2.2.1]heptanyl)diazene |
|---|---|
| PubChem CID | 72767288 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2,4-dinitrophenyl)-(1,7,7-trimethyl-2-nitro-2-bicyclo[2.2.1]heptanyl)diazene |
| SMILES | CC1(C)C2CCC1(C)C(/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])([N+](=O)[O-])C2 |
| InChI | InChI=1S/C16H19N5O6/c1-14(2)10-6-7-15(14,3)16(9-10,21(26)27)18-17-12-5-4-11(19(22)23)8-13(12)20(24)25/h4-5,8,10H,6-7,9H2,1-3H3/b18-17+ |
| InChIKey | UYUKKNCOVQDSGZ-ISLYRVAYSA-N |
| XLogP | 4.41 |
| TPSA | 154.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|