C17H14N4O4 — CID 118343792
(2E,4Z)-N-(2,4-dinitrophenyl)-3-pyridin-4-ylhexa-2,4-dien-1-imine (PubChem CID 118343792) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is (2E,4Z)-N-(2,4-dinitrophenyl)-3-pyridin-4-ylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-N-(2,4-dinitrophenyl)-3-pyridin-4-ylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 118343792 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2E,4Z)-N-(2,4-dinitrophenyl)-3-pyridin-4-ylhexa-2,4-dien-1-imine |
| SMILES | C/C=C\C(=C/C=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccncc1 |
| InChI | InChI=1S/C17H14N4O4/c1-2-3-13(14-6-9-18-10-7-14)8-11-19-16-5-4-15(20(22)23)12-17(16)21(24)25/h2-12H,1H3/b3-2-,13-8+,19-11+ |
| InChIKey | NXWJQJNCLVECRQ-VKBJUZGBSA-N |
| XLogP | 4.26 |
| TPSA | 111.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|