C17H18N2O — CID 176992135
2-(cyclohexa-1,3-dien-1-ylmethyl)-3-ethylquinazolin-4-one (PubChem CID 176992135) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(cyclohexa-1,3-dien-1-ylmethyl)-3-ethylquinazolin-4-one.
| Compound Name | 2-(cyclohexa-1,3-dien-1-ylmethyl)-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 176992135 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(cyclohexa-1,3-dien-1-ylmethyl)-3-ethylquinazolin-4-one |
| SMILES | CCn1c(CC2=CC=CCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H18N2O/c1-2-19-16(12-13-8-4-3-5-9-13)18-15-11-7-6-10-14(15)17(19)20/h3-4,6-8,10-11H,2,5,9,12H2,1H3 |
| InChIKey | ABJXHDWHSPUZMC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |