C11H12OS — CID 90732158
2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxathiine (PubChem CID 90732158) has the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. Its IUPAC name is 2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxathiine.
| Compound Name | 2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxathiine |
|---|---|
| PubChem CID | 90732158 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-oxathiine |
| SMILES | C1=CCCC(CC2=CSC=CO2)=C1 |
| InChI | InChI=1S/C11H12OS/c1-2-4-10(5-3-1)8-11-9-13-7-6-12-11/h1-2,4,6-7,9H,3,5,8H2 |
| InChIKey | CEXKQVCYEYPPJZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |