C12H12O3 — CID 90911657
5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-carbaldehyde (PubChem CID 90911657) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-carbaldehyde.
| Compound Name | 5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-carbaldehyde |
|---|---|
| PubChem CID | 90911657 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-carbaldehyde |
| SMILES | O=CC1=COC(CC2=CC=CCC2)=CO1 |
| InChI | InChI=1S/C12H12O3/c13-7-12-9-14-11(8-15-12)6-10-4-2-1-3-5-10/h1-2,4,7-9H,3,5-6H2 |
| InChIKey | CZKNBWSETWFVLB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|