C28H36N2O3 — CID 90765772
1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[4-(2-prop-2-enylphenoxy)butyl]piperazine (PubChem CID 90765772) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[4-(2-prop-2-enylphenoxy)butyl]piperazine.
| Compound Name | 1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[4-(2-prop-2-enylphenoxy)butyl]piperazine |
|---|---|
| PubChem CID | 90765772 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 1-[5-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-4-[4-(2-prop-2-enylphenoxy)butyl]piperazine |
| SMILES | C=CCc1ccccc1OCCCCN1CCN(C2=COC(CC3=CC=CCC3)=CO2)CC1 |
| InChI | InChI=1S/C28H36N2O3/c1-2-10-25-13-6-7-14-27(25)31-20-9-8-15-29-16-18-30(19-17-29)28-23-32-26(22-33-28)21-24-11-4-3-5-12-24/h2-4,6-7,11,13-14,22-23H,1,5,8-10,12,15-21H2 |
| InChIKey | USKXLYNNAKVFRB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|