C23H24O5 — CID 91584549
bis[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]methanol (PubChem CID 91584549) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is bis[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]methanol.
| Compound Name | bis[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]methanol |
|---|---|
| PubChem CID | 91584549 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | bis[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]methanol |
| SMILES | OC(C1=COC=C(CC2=CC=CCC2)O1)C1=COC=C(CC2=CC=CCC2)O1 |
| InChI | InChI=1S/C23H24O5/c24-23(21-15-25-13-19(27-21)11-17-7-3-1-4-8-17)22-16-26-14-20(28-22)12-18-9-5-2-6-10-18/h1-3,5,7,9,13-16,23-24H,4,6,8,10-12H2 |
| InChIKey | ORVVXYNYCKJPNU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |