C9H9N3O5 — CID 175006917
N-(2,5-dioxopyrrolidin-1-yl)-2,5-dioxopyrrolidine-1-carboxamide (PubChem CID 175006917) has the molecular formula C9H9N3O5 and a molecular weight of 239.19 g/mol. Its IUPAC name is N-(2,5-dioxopyrrolidin-1-yl)-2,5-dioxopyrrolidine-1-carboxamide.
| Compound Name | N-(2,5-dioxopyrrolidin-1-yl)-2,5-dioxopyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 175006917 |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N-(2,5-dioxopyrrolidin-1-yl)-2,5-dioxopyrrolidine-1-carboxamide |
| SMILES | O=C1CCC(=O)N1NC(=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C9H9N3O5/c13-5-1-2-6(14)11(5)9(17)10-12-7(15)3-4-8(12)16/h1-4H2,(H,10,17) |
| InChIKey | UBTDIZIFQBVRCW-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|