C7H7Cl2NO3 — CID 174830023
1-(2,2-dichloroacetyl)piperidine-2,6-dione (PubChem CID 174830023) has the molecular formula C7H7Cl2NO3 and a molecular weight of 224.04 g/mol. Its IUPAC name is 1-(2,2-dichloroacetyl)piperidine-2,6-dione.
| Compound Name | 1-(2,2-dichloroacetyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 174830023 |
| Molecular Formula | C7H7Cl2NO3 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | 1-(2,2-dichloroacetyl)piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C7H7Cl2NO3/c8-6(9)7(13)10-4(11)2-1-3-5(10)12/h6H,1-3H2 |
| InChIKey | XZVQSSKOBCKDFV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|