C10H14Cl4N2O2 — CID 840950
2,2-dichloro-1-[(2S,5R)-4-(2,2-dichloroacetyl)-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 840950) has the molecular formula C10H14Cl4N2O2 and a molecular weight of 336.05 g/mol. Its IUPAC name is 2,2-dichloro-1-[(2S,5R)-4-(2,2-dichloroacetyl)-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[(2S,5R)-4-(2,2-dichloroacetyl)-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 840950 |
| Molecular Formula | C10H14Cl4N2O2 |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 2,2-dichloro-1-[(2S,5R)-4-(2,2-dichloroacetyl)-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)C(Cl)Cl)[C@@H](C)CN1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C10H14Cl4N2O2/c1-5-3-16(10(18)8(13)14)6(2)4-15(5)9(17)7(11)12/h5-8H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | SDOONCCYDHUSEZ-OLQVQODUSA-N |
| XLogP | 2.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|