C8H13Cl2NO — CID 3528857
2,2-dichloro-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 3528857) has the molecular formula C8H13Cl2NO and a molecular weight of 210.10 g/mol. Its IUPAC name is 2,2-dichloro-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 3528857 |
| Molecular Formula | C8H13Cl2NO |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2,2-dichloro-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCCN1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C8H13Cl2NO/c1-6-4-2-3-5-11(6)8(12)7(9)10/h6-7H,2-5H2,1H3 |
| InChIKey | AVLQNLCOAPPKKN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|