C6H8Cl2N2O — CID 13423649
2,2-dichloro-1-(3-methyl-3,4-dihydropyrazol-2-yl)ethanone (PubChem CID 13423649) has the molecular formula C6H8Cl2N2O and a molecular weight of 195.05 g/mol. Its IUPAC name is 2,2-dichloro-1-(3-methyl-3,4-dihydropyrazol-2-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(3-methyl-3,4-dihydropyrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 13423649 |
| Molecular Formula | C6H8Cl2N2O |
| Molecular Weight | 195.05 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 2,2-dichloro-1-(3-methyl-3,4-dihydropyrazol-2-yl)ethanone |
| SMILES | CC1CC=NN1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C6H8Cl2N2O/c1-4-2-3-9-10(4)6(11)5(7)8/h3-5H,2H2,1H3 |
| InChIKey | PHEIVEKFWPQGHD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.05 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|