(3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid

C5H6N2O4 — CID 140600044

IUPAC(3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid
SMILESO=C(O)[C@@H]1CC=NN1C(=O)O
InChIInChI=1S/C5H6N2O4/c8-4(9)3-1-2-6-7(3)5(10)11/h2-3H,1H2,(H,8,9)(H,10,11)/t3-/m0/s1
InChIKeyPSEFWMGUIGBSMX-VKHMYHEASA-N
MW158.11 g/mol
LogP-0.19
Rot. Bonds1

About (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid

(3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid (PubChem CID 140600044) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid.

Molecular Properties

Compound Name(3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid
PubChem CID140600044
Molecular FormulaC5H6N2O4
Molecular Weight158.11 g/mol
Exact Mass158.03
IUPAC Name(3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid
SMILESO=C(O)[C@@H]1CC=NN1C(=O)O
InChIInChI=1S/C5H6N2O4/c8-4(9)3-1-2-6-7(3)5(10)11/h2-3H,1H2,(H,8,9)(H,10,11)/t3-/m0/s1
InChIKeyPSEFWMGUIGBSMX-VKHMYHEASA-N
XLogP-0.19
TPSA90.20 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.11
LogP ≤ 5-0.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid?
The IUPAC name of (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid (CID 140600044) is (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid.
What is the SMILES notation for (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid?
The canonical SMILES for (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid is O=C(O)[C@@H]1CC=NN1C(=O)O.
What is the InChIKey of (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid?
The InChIKey is PSEFWMGUIGBSMX-VKHMYHEASA-N. The full InChI is InChI=1S/C5H6N2O4/c8-4(9)3-1-2-6-7(3)5(10)11/h2-3H,1H2,(H,8,9)(H,10,11)/t3-/m0/s1.
What are the key properties of (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid?
(3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid has a molecular weight of 158.11 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,4-dihydropyrazole-2,3-dicarboxylic acid is sourced from PubChem (CID 140600044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).