C8H11NO6 — CID 22987898
piperidine-1,2,6-tricarboxylic acid (PubChem CID 22987898) has the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. Its IUPAC name is piperidine-1,2,6-tricarboxylic acid.
| Compound Name | piperidine-1,2,6-tricarboxylic acid |
|---|---|
| PubChem CID | 22987898 |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | piperidine-1,2,6-tricarboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)O)N1C(=O)O |
| InChI | InChI=1S/C8H11NO6/c10-6(11)4-2-1-3-5(7(12)13)9(4)8(14)15/h4-5H,1-3H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | QGTZWKPSXZYWOQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |