About (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate
(2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate (PubChem CID 156642898) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate.
Molecular Properties
| Compound Name | (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate |
| PubChem CID | 156642898 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate |
| SMILES | O.O=C(O)[C@@H]1CCCN1O |
| InChI | InChI=1S/C5H9NO3.H2O/c7-5(8)4-2-1-3-6(4)9;/h4,9H,1-3H2,(H,7,8);1H2/t4-;/m0./s1 |
| InChIKey | RQVXUKURXZZJBY-WCCKRBBISA-N |
| XLogP | -0.90 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate?
The IUPAC name of (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate (CID 156642898) is (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate.
What is the SMILES notation for (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate?
The canonical SMILES for (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate is O.O=C(O)[C@@H]1CCCN1O.
What is the InChIKey of (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate?
The InChIKey is RQVXUKURXZZJBY-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO3.H2O/c7-5(8)4-2-1-3-6(4)9;/h4,9H,1-3H2,(H,7,8);1H2/t4-;/m0./s1.
What are the key properties of (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate?
(2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate has a molecular weight of 149.15 g/mol, XLogP of -0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-hydroxypyrrolidine-2-carboxylic acid;hydrate is sourced from PubChem (CID 156642898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).