C5H9NNa2O3 — CID 175713287
CID 175713287 (PubChem CID 175713287) has the molecular formula C5H9NNa2O3 and a molecular weight of 177.11 g/mol.
| Compound Name | CID 175713287 |
|---|---|
| PubChem CID | 175713287 |
| Molecular Formula | C5H9NNa2O3 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@@H]1CCCN1O.[Na].[Na] |
| InChI | InChI=1S/C5H9NO3.2Na/c7-5(8)4-2-1-3-6(4)9;;/h4,9H,1-3H2,(H,7,8);;/t4-;;/m0../s1 |
| InChIKey | INXGEUMQGACGTQ-FHNDMYTFSA-N |
| XLogP | -0.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |