azane;1-hydroxypyrrolidine-2-carboxylic acid

C5H15N3O3 — CID 138563399

IUPACazane;1-hydroxypyrrolidine-2-carboxylic acid
SMILESN.N.O=C(O)C1CCCN1O
InChIInChI=1S/C5H9NO3.2H3N/c7-5(8)4-2-1-3-6(4)9;;/h4,9H,1-3H2,(H,7,8);2*1H3
InChIKeyZLCLYRZCNVJKTA-UHFFFAOYSA-N
MW165.19 g/mol
LogP0.25
Rot. Bonds1

About azane;1-hydroxypyrrolidine-2-carboxylic acid

azane;1-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 138563399) has the molecular formula C5H15N3O3 and a molecular weight of 165.19 g/mol. Its IUPAC name is azane;1-hydroxypyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Nameazane;1-hydroxypyrrolidine-2-carboxylic acid
PubChem CID138563399
Molecular FormulaC5H15N3O3
Molecular Weight165.19 g/mol
Exact Mass165.11
IUPAC Nameazane;1-hydroxypyrrolidine-2-carboxylic acid
SMILESN.N.O=C(O)C1CCCN1O
InChIInChI=1S/C5H9NO3.2H3N/c7-5(8)4-2-1-3-6(4)9;;/h4,9H,1-3H2,(H,7,8);2*1H3
InChIKeyZLCLYRZCNVJKTA-UHFFFAOYSA-N
XLogP0.25
TPSA130.77 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.19
LogP ≤ 50.25
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze azane;1-hydroxypyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;1-hydroxypyrrolidine-2-carboxylic acid?
The IUPAC name of azane;1-hydroxypyrrolidine-2-carboxylic acid (CID 138563399) is azane;1-hydroxypyrrolidine-2-carboxylic acid.
What is the SMILES notation for azane;1-hydroxypyrrolidine-2-carboxylic acid?
The canonical SMILES for azane;1-hydroxypyrrolidine-2-carboxylic acid is N.N.O=C(O)C1CCCN1O.
What is the InChIKey of azane;1-hydroxypyrrolidine-2-carboxylic acid?
The InChIKey is ZLCLYRZCNVJKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.2H3N/c7-5(8)4-2-1-3-6(4)9;;/h4,9H,1-3H2,(H,7,8);2*1H3.
What are the key properties of azane;1-hydroxypyrrolidine-2-carboxylic acid?
azane;1-hydroxypyrrolidine-2-carboxylic acid has a molecular weight of 165.19 g/mol, XLogP of 0.25, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-hydroxypyrrolidine-2-carboxylic acid is sourced from PubChem (CID 138563399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).