About azane;1-hydroxypyrrolidine-2-carboxylic acid
azane;1-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 138563399) has the molecular formula C5H15N3O3
and a molecular weight of 165.19 g/mol. Its IUPAC name is azane;1-hydroxypyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | azane;1-hydroxypyrrolidine-2-carboxylic acid |
| PubChem CID | 138563399 |
| Molecular Formula | C5H15N3O3 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | azane;1-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | N.N.O=C(O)C1CCCN1O |
| InChI | InChI=1S/C5H9NO3.2H3N/c7-5(8)4-2-1-3-6(4)9;;/h4,9H,1-3H2,(H,7,8);2*1H3 |
| InChIKey | ZLCLYRZCNVJKTA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;1-hydroxypyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-hydroxypyrrolidine-2-carboxylic acid?
The IUPAC name of azane;1-hydroxypyrrolidine-2-carboxylic acid (CID 138563399) is azane;1-hydroxypyrrolidine-2-carboxylic acid.
What is the SMILES notation for azane;1-hydroxypyrrolidine-2-carboxylic acid?
The canonical SMILES for azane;1-hydroxypyrrolidine-2-carboxylic acid is N.N.O=C(O)C1CCCN1O.
What is the InChIKey of azane;1-hydroxypyrrolidine-2-carboxylic acid?
The InChIKey is ZLCLYRZCNVJKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.2H3N/c7-5(8)4-2-1-3-6(4)9;;/h4,9H,1-3H2,(H,7,8);2*1H3.
What are the key properties of azane;1-hydroxypyrrolidine-2-carboxylic acid?
azane;1-hydroxypyrrolidine-2-carboxylic acid has a molecular weight of 165.19 g/mol, XLogP of 0.25, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-hydroxypyrrolidine-2-carboxylic acid is sourced from PubChem (CID 138563399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).