About 1-methylpyrrolidine-2-carboxylic acid;hydrate
1-methylpyrrolidine-2-carboxylic acid;hydrate (PubChem CID 2849411) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 1-methylpyrrolidine-2-carboxylic acid;hydrate.
Molecular Properties
| Compound Name | 1-methylpyrrolidine-2-carboxylic acid;hydrate |
| PubChem CID | 2849411 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 1-methylpyrrolidine-2-carboxylic acid;hydrate |
| SMILES | CN1CCCC1C(=O)O.O |
| InChI | InChI=1S/C6H11NO2.H2O/c1-7-4-2-3-5(7)6(8)9;/h5H,2-4H2,1H3,(H,8,9);1H2 |
| InChIKey | IXBKFJZWNAVSHW-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpyrrolidine-2-carboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidine-2-carboxylic acid;hydrate?
The IUPAC name of 1-methylpyrrolidine-2-carboxylic acid;hydrate (CID 2849411) is 1-methylpyrrolidine-2-carboxylic acid;hydrate.
What is the SMILES notation for 1-methylpyrrolidine-2-carboxylic acid;hydrate?
The canonical SMILES for 1-methylpyrrolidine-2-carboxylic acid;hydrate is CN1CCCC1C(=O)O.O.
What is the InChIKey of 1-methylpyrrolidine-2-carboxylic acid;hydrate?
The InChIKey is IXBKFJZWNAVSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.H2O/c1-7-4-2-3-5(7)6(8)9;/h5H,2-4H2,1H3,(H,8,9);1H2.
What are the key properties of 1-methylpyrrolidine-2-carboxylic acid;hydrate?
1-methylpyrrolidine-2-carboxylic acid;hydrate has a molecular weight of 147.17 g/mol, XLogP of -0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidine-2-carboxylic acid;hydrate is sourced from PubChem (CID 2849411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).