C15H28N2O3 — CID 160589871
(2R)-1-methylpiperidine-2-carboxylic acid;1-[(2R)-1-methylpiperidin-2-yl]ethanone (PubChem CID 160589871) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R)-1-methylpiperidine-2-carboxylic acid;1-[(2R)-1-methylpiperidin-2-yl]ethanone.
| Compound Name | (2R)-1-methylpiperidine-2-carboxylic acid;1-[(2R)-1-methylpiperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 160589871 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2R)-1-methylpiperidine-2-carboxylic acid;1-[(2R)-1-methylpiperidin-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1CCCCN1C.CN1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C8H15NO.C7H13NO2/c1-7(10)8-5-3-4-6-9(8)2;1-8-5-3-2-4-6(8)7(9)10/h8H,3-6H2,1-2H3;6H,2-5H2,1H3,(H,9,10)/t8-;6-/m11/s1 |
| InChIKey | RCWIKKURSWPACF-WNXIGWQFSA-N |
| XLogP | 1.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |