About ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal
ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal (PubChem CID 143105451) has the molecular formula C14H31NO2
and a molecular weight of 245.41 g/mol. Its IUPAC name is ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal.
Molecular Properties
| Compound Name | ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal |
| PubChem CID | 143105451 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal |
| SMILES | CC.CC.CC(=O)C1CCCN1C.CCC=O |
| InChI | InChI=1S/C7H13NO.C3H6O.2C2H6/c1-6(9)7-4-3-5-8(7)2;1-2-3-4;2*1-2/h7H,3-5H2,1-2H3;3H,2H2,1H3;2*1-2H3 |
| InChIKey | ZKOVURVKOXEXQE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal?
The IUPAC name of ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal (CID 143105451) is ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal.
What is the SMILES notation for ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal?
The canonical SMILES for ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal is CC.CC.CC(=O)C1CCCN1C.CCC=O.
What is the InChIKey of ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal?
The InChIKey is ZKOVURVKOXEXQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H6O.2C2H6/c1-6(9)7-4-3-5-8(7)2;1-2-3-4;2*1-2/h7H,3-5H2,1-2H3;3H,2H2,1H3;2*1-2H3.
What are the key properties of ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal?
ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal has a molecular weight of 245.41 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(1-methylpyrrolidin-2-yl)ethanone;propanal is sourced from PubChem (CID 143105451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).