About 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone
2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone (PubChem CID 143816509) has the molecular formula C9H20N4O
and a molecular weight of 200.29 g/mol. Its IUPAC name is 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone |
| PubChem CID | 143816509 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone |
| SMILES | CC(=O)C1CCCN1C.CN=C(N)N |
| InChI | InChI=1S/C7H13NO.C2H7N3/c1-6(9)7-4-3-5-8(7)2;1-5-2(3)4/h7H,3-5H2,1-2H3;1H3,(H4,3,4,5) |
| InChIKey | HQKRFDHTARXNKQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone?
The IUPAC name of 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone (CID 143816509) is 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone.
What is the SMILES notation for 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone?
The canonical SMILES for 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone is CC(=O)C1CCCN1C.CN=C(N)N.
What is the InChIKey of 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone?
The InChIKey is HQKRFDHTARXNKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C2H7N3/c1-6(9)7-4-3-5-8(7)2;1-5-2(3)4/h7H,3-5H2,1-2H3;1H3,(H4,3,4,5).
What are the key properties of 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone?
2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone has a molecular weight of 200.29 g/mol, XLogP of -0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylguanidine;1-(1-methylpyrrolidin-2-yl)ethanone is sourced from PubChem (CID 143816509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).