About 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone
2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone (PubChem CID 143816508) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone |
| PubChem CID | 143816508 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone |
| SMILES | CC(=O)C1CCCN1C.COCC(=O)O |
| InChI | InChI=1S/C7H13NO.C3H6O3/c1-6(9)7-4-3-5-8(7)2;1-6-2-3(4)5/h7H,3-5H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | WQAKOJLKKPSNRP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone?
The IUPAC name of 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone (CID 143816508) is 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone.
What is the SMILES notation for 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone?
The canonical SMILES for 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone is CC(=O)C1CCCN1C.COCC(=O)O.
What is the InChIKey of 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone?
The InChIKey is WQAKOJLKKPSNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H6O3/c1-6(9)7-4-3-5-8(7)2;1-6-2-3(4)5/h7H,3-5H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone?
2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone has a molecular weight of 217.26 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyacetic acid;1-(1-methylpyrrolidin-2-yl)ethanone is sourced from PubChem (CID 143816508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).