C18H22N2O — CID 167538208
1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 167538208) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
|---|---|
| PubChem CID | 167538208 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(C1CC2CCCC2C1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C18H22N2O/c21-18(16-11-14-7-4-8-15(14)12-16)20-17(9-10-19-20)13-5-2-1-3-6-13/h1-3,5-6,10,14-17H,4,7-9,11-12H2 |
| InChIKey | AAKQBOOGTWBAJP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |